CaCo3+HNO3=Ca(No3)2+H2CO2 m(H2NO3)=25г W-10% M(CO2)-?

Предыдущий
вопрос Следующий
вопрос

First, we need to balance the chemical equation for the reaction between CaCO3 and HNO3:

CaCO3 + 2HNO3 = Ca(NO3)2 + H2CO3

Next, we need to calculate the molar mass of CaCO2:

CaCO3 = 140 + 112 + 3*16 = 100 g/mol

Then, we can calculate the molar mass of CO2:

CO2 = 12 + 2*16 = 44 g/mol

Since we have 10% by weight of CaCO3 in the reaction, we can calculate the weight of CaCO3:

25g / 0.1 = 250g

Finally, we can use the molar mass of CaCO3 to calculate the moles of CaCO3, then use the balanced chemical equation to calculate the moles of CO2 produced, and finally calculate the weight of CO2 produced:

moles of CaCO3 = 250g / 100g/mol = 2.5 mo
moles of CO2 = 2.5 mol 1 mol/1 mol = 2.5 mo
weight of CO2 = 2.5 mol 44 g/mol = 110 g

Therefore, the weight of CO2 produced in this reaction is 110 grams.