S-So2-SO3-H2SO4-CA(HSO4)2- - ZnSO4-Zn(OH)2

Предыдущий
вопрос Следующий
вопрос

The reaction pathway that starts with sulfur dioxide (SO2) and ends with zinc hydroxide (Zn(OH)2) involves several steps.

SO2 is oxidized to SO3 in the presence of oxygen.
2SO2 + O2 -> 2SO3

SO3 reacts with water to form sulfuric acid (H2SO4).
SO3 + H2O -> H2SO4

Sulfuric acid donates a proton to form bisulfate ions (HSO4^-).
H2SO4 -> H^+ + HSO4^-

Zinc sulfate (ZnSO4) dissociates into zinc ions (Zn^2+) and sulfate ions (SO4^2-).
ZnSO4 -> Zn^2+ + SO4^2-

Zinc ions react with hydroxide ions (OH^-) to form zinc hydroxide (Zn(OH)2).
Zn^2+ + 2OH^- -> Zn(OH)2

Overall reaction:
2SO2 + O2 + 2H2O + ZnSO4 -> 2H2SO4 + Zn(OH)2

Note: This is a general overview of the reaction pathway. Depending on the conditions of the reaction, additional intermediate steps or side reactions may occur.