N2-NO-NO2-HNO3-CU(NO3)2-Cu

Предыдущий
вопрос Следующий
вопрос

This is a series of chemical reactions involving the transformation of nitrogen and copper compounds. Here is the reaction pathway:

N2 (Nitrogen gas) reacts with oxygen gas to form NO (Nitric oxide) and NO2 (Nitrogen dioxide):
N2 + O2 -> 2NO
2NO + O2 -> 2NO2

NO2 reacts with water to form nitric acid (HNO3):
3NO2 + H2O -> 2HNO3 + NO

Lastly, copper (Cu) reacts with nitric acid to form copper(II) nitrate, Cu(NO3)2, and nitric oxide gas:
3Cu + 8HNO3 -> 3Cu(NO3)2 + 4H2O + 2NO

Overall reaction:
N2 + 3O2 + 6H2O + 3Cu -> 3Cu(NO3)2 + 4H2O + 2NO

This series of reactions illustrates the conversion of nitrogen gas and copper metal into copper(II) nitrate using a chemical pathway involving NO, NO2, HNO3, and Cu(NO3)2.