Cr-CrCl3-Cr(OH)3-Cr2O3-Cr

Предыдущий
вопрос Следующий
вопрос

The chemical reactions involved in the transformation of chromium (Cr) into various compounds such as chromium chloride (CrCl3), chromium hydroxide (Cr(OH)3), and chromium oxide (Cr2O3) are complex and usually occur through separate processes.

Chromium Chloride (CrCl3):
2 Cr + 3 Cl2 → 2 CrCl3

Chromium Hydroxide (Cr(OH)3):
CrCl3 + 3 NaOH → Cr(OH)3 + 3 NaCl

Chromium Oxide (Cr2O3):
4 Cr(OH)3 + 3 O2 → 2 Cr2O3 + 6 H2O

Overall, the transformation of chromium from its elemental form to chromium chloride, chromium hydroxide, and chromium oxide involves a series of chemical reactions that typically involve the addition of appropriate reagents such as chlorine, sodium hydroxide, and oxygen.